C28H26FN3O2 — CID 57425638
N-[(1R)-1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl]-4-phenylbutanamide (PubChem CID 57425638) has the molecular formula C28H26FN3O2 and a molecular weight of 455.53 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl]-4-phenylbutanamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 57425638 |
| Molecular Formula | C28H26FN3O2 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)-2-hydroxy-2,2-dipyridin-3-ylethyl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)N[C@H](c1ccc(F)cc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C28H26FN3O2/c29-25-15-13-22(14-16-25)27(32-26(33)12-4-9-21-7-2-1-3-8-21)28(34,23-10-5-17-30-19-23)24-11-6-18-31-20-24/h1-3,5-8,10-11,13-20,27,34H,4,9,12H2,(H,32,33)/t27-/m1/s1 |
| InChIKey | SERDRYISRDYVOG-HHHXNRCGSA-N |
| XLogP | 4.73 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |