C25H25F2NO2 — CID 22261775
N-[1,3-bis(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylbutanamide (PubChem CID 22261775) has the molecular formula C25H25F2NO2 and a molecular weight of 409.48 g/mol. Its IUPAC name is N-[1,3-bis(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylbutanamide.
| Compound Name | N-[1,3-bis(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 22261775 |
| Molecular Formula | C25H25F2NO2 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[1,3-bis(4-fluorophenyl)-1-hydroxypropan-2-yl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)NC(Cc1ccc(F)cc1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25F2NO2/c26-21-13-9-19(10-14-21)17-23(25(30)20-11-15-22(27)16-12-20)28-24(29)8-4-7-18-5-2-1-3-6-18/h1-3,5-6,9-16,23,25,30H,4,7-8,17H2,(H,28,29) |
| InChIKey | CZVIOFMYRZXCJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |