C23H27FN2O3 — CID 87133874
(2S)-2-[3-(4-fluorophenyl)propanoylamino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)butanamide (PubChem CID 87133874) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is (2S)-2-[3-(4-fluorophenyl)propanoylamino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)butanamide.
| Compound Name | (2S)-2-[3-(4-fluorophenyl)propanoylamino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)butanamide |
|---|---|
| PubChem CID | 87133874 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (2S)-2-[3-(4-fluorophenyl)propanoylamino]-3-methyl-N-(1-oxo-3-phenylpropan-2-yl)butanamide |
| SMILES | CC(C)[C@H](NC(=O)CCc1ccc(F)cc1)C(=O)NC(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H27FN2O3/c1-16(2)22(26-21(28)13-10-17-8-11-19(24)12-9-17)23(29)25-20(15-27)14-18-6-4-3-5-7-18/h3-9,11-12,15-16,20,22H,10,13-14H2,1-2H3,(H,25,29)(H,26,28)/t20?,22-/m0/s1 |
| InChIKey | RCTCBTQLYAOUQS-IAXKEJLGSA-N |
| XLogP | 2.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|