C23H34N2O8 — CID 56836474
methyl 2-[2-[2-[2-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]acetate (PubChem CID 56836474) has the molecular formula C23H34N2O8 and a molecular weight of 466.53 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]acetate.
| Compound Name | methyl 2-[2-[2-[2-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 56836474 |
| Molecular Formula | C23H34N2O8 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | methyl 2-[2-[2-[2-[[(2S)-3-methyl-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]butan-2-yl]amino]-2-oxoethoxy]ethoxy]ethoxy]acetate |
| SMILES | COC(=O)COCCOCCOCC(=O)N[C@H](C(=O)NC(C=O)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C23H34N2O8/c1-17(2)22(23(29)24-19(14-26)13-18-7-5-4-6-8-18)25-20(27)15-32-11-9-31-10-12-33-16-21(28)30-3/h4-8,14,17,19,22H,9-13,15-16H2,1-3H3,(H,24,29)(H,25,27)/t19?,22-/m0/s1 |
| InChIKey | WDYDCUWIUWUWGF-BPARTEKVSA-N |
| XLogP | 0.28 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|