C22H32N2O6 — CID 88564812
methyl 6-[[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate (PubChem CID 88564812) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl 6-[[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate.
| Compound Name | methyl 6-[[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 88564812 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | methyl 6-[[(2S)-1-[[1-(4-methoxyphenyl)-3-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N[C@H](C(=O)NC(C=O)Cc1ccc(OC)cc1)C(C)C |
| InChI | InChI=1S/C22H32N2O6/c1-15(2)21(24-19(26)7-5-6-8-20(27)30-4)22(28)23-17(14-25)13-16-9-11-18(29-3)12-10-16/h9-12,14-15,17,21H,5-8,13H2,1-4H3,(H,23,28)(H,24,26)/t17?,21-/m0/s1 |
| InChIKey | SQRWCBPTKOINKA-LFABVHOISA-N |
| XLogP | 1.80 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|