C24H36N4O8 — CID 176651940
[4-(hydroxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-2-[(5-methoxy-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoate (PubChem CID 176651940) has the molecular formula C24H36N4O8 and a molecular weight of 508.57 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-2-[(5-methoxy-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoate.
| Compound Name | [4-(hydroxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-2-[(5-methoxy-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 176651940 |
| Molecular Formula | C24H36N4O8 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [4-(hydroxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-2-[(5-methoxy-5-oxopentanoyl)amino]-3-methylbutanoyl]amino]pentanoate |
| SMILES | COC(=O)CCCC(=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)Oc1ccc(CO)cc1)C(C)C |
| InChI | InChI=1S/C24H36N4O8/c1-15(2)21(28-19(30)7-4-8-20(31)35-3)22(32)27-18(6-5-13-26-24(25)34)23(33)36-17-11-9-16(14-29)10-12-17/h9-12,15,18,21,29H,4-8,13-14H2,1-3H3,(H,27,32)(H,28,30)(H3,25,26,34)/t18-,21-/m0/s1 |
| InChIKey | WSKYDGKIPPYNFJ-RXVVDRJESA-N |
| XLogP | 0.50 |
| TPSA | 186.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|