C29H38N4O8 — CID 89161773
[4-(propanoyloxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoate (PubChem CID 89161773) has the molecular formula C29H38N4O8 and a molecular weight of 570.64 g/mol. Its IUPAC name is [4-(propanoyloxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoate.
| Compound Name | [4-(propanoyloxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 89161773 |
| Molecular Formula | C29H38N4O8 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | [4-(propanoyloxymethyl)phenyl] (2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanoate |
| SMILES | CCC(=O)OCc1ccc(OC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C29H38N4O8/c1-4-24(34)39-17-21-12-14-22(15-13-21)41-27(36)23(11-8-16-31-28(30)37)32-26(35)25(19(2)3)33-29(38)40-18-20-9-6-5-7-10-20/h5-7,9-10,12-15,19,23,25H,4,8,11,16-18H2,1-3H3,(H,32,35)(H,33,38)(H3,30,31,37)/t23-,25-/m0/s1 |
| InChIKey | TXAFGSVVGZGMGN-ZCYQVOJMSA-N |
| XLogP | 2.93 |
| TPSA | 175.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|