C27H39N3O6 — CID 56836851
methyl 8-[[(2S)-1-[[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate (PubChem CID 56836851) has the molecular formula C27H39N3O6 and a molecular weight of 501.62 g/mol. Its IUPAC name is methyl 8-[[(2S)-1-[[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate.
| Compound Name | methyl 8-[[(2S)-1-[[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 56836851 |
| Molecular Formula | C27H39N3O6 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | methyl 8-[[(2S)-1-[[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)N[C@H](C(=O)NC(Cc1ccccc1)C(=O)C(=O)NC1CC1)C(C)C |
| InChI | InChI=1S/C27H39N3O6/c1-18(2)24(30-22(31)13-9-4-5-10-14-23(32)36-3)26(34)29-21(17-19-11-7-6-8-12-19)25(33)27(35)28-20-15-16-20/h6-8,11-12,18,20-21,24H,4-5,9-10,13-17H2,1-3H3,(H,28,35)(H,29,34)(H,30,31)/t21?,24-/m0/s1 |
| InChIKey | VEAIRIAEJWXTTG-FHZUCYEKSA-N |
| XLogP | 2.22 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|