C20H27N3O5 — CID 139578370
[(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl] carbamate (PubChem CID 139578370) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl] carbamate.
| Compound Name | [(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl] carbamate |
|---|---|
| PubChem CID | 139578370 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl] carbamate |
| SMILES | CC(C)C[C@H](OC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C20H27N3O5/c1-12(2)10-16(28-20(21)27)18(25)23-15(11-13-6-4-3-5-7-13)17(24)19(26)22-14-8-9-14/h3-7,12,14-16H,8-11H2,1-2H3,(H2,21,27)(H,22,26)(H,23,25)/t15-,16-/m0/s1 |
| InChIKey | BAZSLZDCVJQTBV-HOTGVXAUSA-N |
| XLogP | 1.07 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|