C31H34N2O5 — CID 24901430
methyl 3-[[(2S)-2-[(2,2-diphenylacetyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-phenylbutanoate (PubChem CID 24901430) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-[(2,2-diphenylacetyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-phenylbutanoate.
| Compound Name | methyl 3-[[(2S)-2-[(2,2-diphenylacetyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 24901430 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | methyl 3-[[(2S)-2-[(2,2-diphenylacetyl)amino]-4-methylpentanoyl]amino]-2-oxo-4-phenylbutanoate |
| SMILES | COC(=O)C(=O)C(Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34N2O5/c1-21(2)19-26(29(35)32-25(28(34)31(37)38-3)20-22-13-7-4-8-14-22)33-30(36)27(23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,21,25-27H,19-20H2,1-3H3,(H,32,35)(H,33,36)/t25?,26-/m0/s1 |
| InChIKey | MQAXROIBCXVIDL-AMVUTOCUSA-N |
| XLogP | 3.82 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|