C24H35N3O6 — CID 69028175
2-methoxyethyl N-[(2S)-1-[[(3S)-1-(cyclopropylamino)-1,2-dioxo-4-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 69028175) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-methoxyethyl N-[(2S)-1-[[(3S)-1-(cyclopropylamino)-1,2-dioxo-4-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[(2S)-1-[[(3S)-1-(cyclopropylamino)-1,2-dioxo-4-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 69028175 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 2-methoxyethyl N-[(2S)-1-[[(3S)-1-(cyclopropylamino)-1,2-dioxo-4-phenylpentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | COCCOC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)C(=O)NC1CC1)C(C)c1ccccc1 |
| InChI | InChI=1S/C24H35N3O6/c1-15(2)14-19(26-24(31)33-13-12-32-4)22(29)27-20(16(3)17-8-6-5-7-9-17)21(28)23(30)25-18-10-11-18/h5-9,15-16,18-20H,10-14H2,1-4H3,(H,25,30)(H,26,31)(H,27,29)/t16?,19-,20-/m0/s1 |
| InChIKey | ILEQIOIFZXSYMW-RFFXKOPCSA-N |
| XLogP | 1.91 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|