C29H45N3O9 — CID 139578357
[2-[2-(2-ethoxyethoxy)ethoxy]-1-methoxyethyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 139578357) has the molecular formula C29H45N3O9 and a molecular weight of 579.69 g/mol. Its IUPAC name is [2-[2-(2-ethoxyethoxy)ethoxy]-1-methoxyethyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | [2-[2-(2-ethoxyethoxy)ethoxy]-1-methoxyethyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 139578357 |
| Molecular Formula | C29H45N3O9 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.32 |
| IUPAC Name | [2-[2-(2-ethoxyethoxy)ethoxy]-1-methoxyethyl] N-[(2S)-1-[[(2S)-4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCOCCOCCOCC(OC)OC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C29H45N3O9/c1-5-38-13-14-39-15-16-40-19-25(37-4)41-29(36)32-24(17-20(2)3)27(34)31-23(18-21-9-7-6-8-10-21)26(33)28(35)30-22-11-12-22/h6-10,20,22-25H,5,11-19H2,1-4H3,(H,30,35)(H,31,34)(H,32,36)/t23-,24-,25?/m0/s1 |
| InChIKey | UUCWZXIQFSGVEN-JWDFLIAJSA-N |
| XLogP | 1.74 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|