C25H39N3O7 — CID 138527365
2-methoxyethyl N-[4-methyl-1-[[(3S)-5-methyl-1,2-dioxo-1-(2-phenoxyethylamino)hexan-3-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 138527365) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-methyl-1-[[(3S)-5-methyl-1,2-dioxo-1-(2-phenoxyethylamino)hexan-3-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-methyl-1-[[(3S)-5-methyl-1,2-dioxo-1-(2-phenoxyethylamino)hexan-3-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138527365 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 2-methoxyethyl N-[4-methyl-1-[[(3S)-5-methyl-1,2-dioxo-1-(2-phenoxyethylamino)hexan-3-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | COCCOC(=O)NC(CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)C(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C25H39N3O7/c1-17(2)15-20(22(29)24(31)26-11-12-34-19-9-7-6-8-10-19)27-23(30)21(16-18(3)4)28-25(32)35-14-13-33-5/h6-10,17-18,20-21H,11-16H2,1-5H3,(H,26,31)(H,27,30)(H,28,32)/t20-,21?/m0/s1 |
| InChIKey | WBBCLQWIHSWOFN-BGERDNNASA-N |
| XLogP | 2.07 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|