C23H33N3O7 — CID 174764745
[(3S)-3-[[(2S)-2-carbamoyloxy-4-methylpentanoyl]amino]-1-(ethylamino)-1-oxo-4-phenylbutan-2-yl] 2-methoxyprop-2-enoate (PubChem CID 174764745) has the molecular formula C23H33N3O7 and a molecular weight of 463.53 g/mol. Its IUPAC name is [(3S)-3-[[(2S)-2-carbamoyloxy-4-methylpentanoyl]amino]-1-(ethylamino)-1-oxo-4-phenylbutan-2-yl] 2-methoxyprop-2-enoate.
| Compound Name | [(3S)-3-[[(2S)-2-carbamoyloxy-4-methylpentanoyl]amino]-1-(ethylamino)-1-oxo-4-phenylbutan-2-yl] 2-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 174764745 |
| Molecular Formula | C23H33N3O7 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | [(3S)-3-[[(2S)-2-carbamoyloxy-4-methylpentanoyl]amino]-1-(ethylamino)-1-oxo-4-phenylbutan-2-yl] 2-methoxyprop-2-enoate |
| SMILES | C=C(OC)C(=O)OC(C(=O)NCC)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)OC(N)=O |
| InChI | InChI=1S/C23H33N3O7/c1-6-25-21(28)19(33-22(29)15(4)31-5)17(13-16-10-8-7-9-11-16)26-20(27)18(12-14(2)3)32-23(24)30/h7-11,14,17-19H,4,6,12-13H2,1-3,5H3,(H2,24,30)(H,25,28)(H,26,27)/t17-,18-,19?/m0/s1 |
| InChIKey | AVZVZNAKGPQTQD-ADUPEVMXSA-N |
| XLogP | 1.43 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|