C28H42N4O4 — CID 10368652
(2S)-2-amino-N-[(2S,3R,4R,5S)-5-[[(2S)-2-amino-3-methylbutanoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]-3-methylbutanamide (PubChem CID 10368652) has the molecular formula C28H42N4O4 and a molecular weight of 498.67 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S,3R,4R,5S)-5-[[(2S)-2-amino-3-methylbutanoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[(2S,3R,4R,5S)-5-[[(2S)-2-amino-3-methylbutanoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 10368652 |
| Molecular Formula | C28H42N4O4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | (2S)-2-amino-N-[(2S,3R,4R,5S)-5-[[(2S)-2-amino-3-methylbutanoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C28H42N4O4/c1-17(2)23(29)27(35)31-21(15-19-11-7-5-8-12-19)25(33)26(34)22(16-20-13-9-6-10-14-20)32-28(36)24(30)18(3)4/h5-14,17-18,21-26,33-34H,15-16,29-30H2,1-4H3,(H,31,35)(H,32,36)/t21-,22-,23-,24-,25+,26+/m0/s1 |
| InChIKey | BABCLRPKNPMXJL-MGEKTERKSA-N |
| XLogP | 1.13 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |