C13H21BN2O3 — CID 74765887
[(1R)-1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 74765887) has the molecular formula C13H21BN2O3 and a molecular weight of 264.13 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 74765887 |
| Molecular Formula | C13H21BN2O3 |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [(1R)-1-[[(2S)-2-amino-3-methylbutanoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C13H21BN2O3/c1-9(2)12(15)13(17)16-11(14(18)19)8-10-6-4-3-5-7-10/h3-7,9,11-12,18-19H,8,15H2,1-2H3,(H,16,17)/t11-,12-/m0/s1 |
| InChIKey | OZGKRRRAJOYNGL-RYUDHWBXSA-N |
| XLogP | -0.29 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|