C18H21BN2O4 — CID 169258199
[(1R)-1-[(3-anilino-2-methyl-3-oxopropanoyl)amino]-2-phenylethyl]boronic acid (PubChem CID 169258199) has the molecular formula C18H21BN2O4 and a molecular weight of 340.19 g/mol. Its IUPAC name is [(1R)-1-[(3-anilino-2-methyl-3-oxopropanoyl)amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[(3-anilino-2-methyl-3-oxopropanoyl)amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 169258199 |
| Molecular Formula | C18H21BN2O4 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(1R)-1-[(3-anilino-2-methyl-3-oxopropanoyl)amino]-2-phenylethyl]boronic acid |
| SMILES | CC(C(=O)Nc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C18H21BN2O4/c1-13(17(22)20-15-10-6-3-7-11-15)18(23)21-16(19(24)25)12-14-8-4-2-5-9-14/h2-11,13,16,24-25H,12H2,1H3,(H,20,22)(H,21,23)/t13?,16-/m0/s1 |
| InChIKey | LJROSPUQSJBFSS-VYIIXAMBSA-N |
| XLogP | 1.00 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|