C27H31BN2O5 — CID 169258186
[(1R)-1-[[3-[2-(3-methoxyphenyl)ethylamino]-2-methyl-3-oxopropanoyl]amino]-2-(4-phenylphenyl)ethyl]boronic acid (PubChem CID 169258186) has the molecular formula C27H31BN2O5 and a molecular weight of 474.37 g/mol. Its IUPAC name is [(1R)-1-[[3-[2-(3-methoxyphenyl)ethylamino]-2-methyl-3-oxopropanoyl]amino]-2-(4-phenylphenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[[3-[2-(3-methoxyphenyl)ethylamino]-2-methyl-3-oxopropanoyl]amino]-2-(4-phenylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 169258186 |
| Molecular Formula | C27H31BN2O5 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(1R)-1-[[3-[2-(3-methoxyphenyl)ethylamino]-2-methyl-3-oxopropanoyl]amino]-2-(4-phenylphenyl)ethyl]boronic acid |
| SMILES | COc1cccc(CCNC(=O)C(C)C(=O)N[C@@H](Cc2ccc(-c3ccccc3)cc2)B(O)O)c1 |
| InChI | InChI=1S/C27H31BN2O5/c1-19(26(31)29-16-15-20-7-6-10-24(17-20)35-2)27(32)30-25(28(33)34)18-21-11-13-23(14-12-21)22-8-4-3-5-9-22/h3-14,17,19,25,33-34H,15-16,18H2,1-2H3,(H,29,31)(H,30,32)/t19?,25-/m0/s1 |
| InChIKey | RVACBILWTDLASF-BIAFCPFJSA-N |
| XLogP | 2.40 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|