C21H26BFN2O6 — CID 174143848
[1-[[2-fluoro-3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropanoyl]amino]-2-(4-methylphenyl)ethoxy]boronic acid (PubChem CID 174143848) has the molecular formula C21H26BFN2O6 and a molecular weight of 432.26 g/mol. Its IUPAC name is [1-[[2-fluoro-3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropanoyl]amino]-2-(4-methylphenyl)ethoxy]boronic acid.
| Compound Name | [1-[[2-fluoro-3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropanoyl]amino]-2-(4-methylphenyl)ethoxy]boronic acid |
|---|---|
| PubChem CID | 174143848 |
| Molecular Formula | C21H26BFN2O6 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [1-[[2-fluoro-3-[2-(3-methoxyphenyl)ethylamino]-3-oxopropanoyl]amino]-2-(4-methylphenyl)ethoxy]boronic acid |
| SMILES | COc1cccc(CCNC(=O)C(F)C(=O)NC(Cc2ccc(C)cc2)OB(O)O)c1 |
| InChI | InChI=1S/C21H26BFN2O6/c1-14-6-8-16(9-7-14)13-18(31-22(28)29)25-21(27)19(23)20(26)24-11-10-15-4-3-5-17(12-15)30-2/h3-9,12,18-19,28-29H,10-11,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | PZDDLYRNGLLMAT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|