C10H14BNO3S — CID 155517666
[(1R)-2-phenyl-1-[(2-sulfanylacetyl)amino]ethyl]boronic acid (PubChem CID 155517666) has the molecular formula C10H14BNO3S and a molecular weight of 239.11 g/mol. Its IUPAC name is [(1R)-2-phenyl-1-[(2-sulfanylacetyl)amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-phenyl-1-[(2-sulfanylacetyl)amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 155517666 |
| Molecular Formula | C10H14BNO3S |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | [(1R)-2-phenyl-1-[(2-sulfanylacetyl)amino]ethyl]boronic acid |
| SMILES | O=C(CS)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C10H14BNO3S/c13-10(7-16)12-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,9,14-16H,6-7H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | TVNFGLNUEGQYOF-VIFPVBQESA-N |
| XLogP | -0.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|