C20H24BNO4 — CID 71617467
[2-(3-ethylphenyl)-1-[(4-oxo-4-phenylbutanoyl)amino]ethyl]boronic acid (PubChem CID 71617467) has the molecular formula C20H24BNO4 and a molecular weight of 353.23 g/mol. Its IUPAC name is [2-(3-ethylphenyl)-1-[(4-oxo-4-phenylbutanoyl)amino]ethyl]boronic acid.
| Compound Name | [2-(3-ethylphenyl)-1-[(4-oxo-4-phenylbutanoyl)amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 71617467 |
| Molecular Formula | C20H24BNO4 |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | [2-(3-ethylphenyl)-1-[(4-oxo-4-phenylbutanoyl)amino]ethyl]boronic acid |
| SMILES | CCc1cccc(CC(NC(=O)CCC(=O)c2ccccc2)B(O)O)c1 |
| InChI | InChI=1S/C20H24BNO4/c1-2-15-7-6-8-16(13-15)14-19(21(25)26)22-20(24)12-11-18(23)17-9-4-3-5-10-17/h3-10,13,19,25-26H,2,11-12,14H2,1H3,(H,22,24) |
| InChIKey | CAIHNZRPTQWNJY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|