C22H27BN4O4 — CID 71616887
[(1R)-2-(3-ethylphenyl)-1-[3-[4-(2-methoxyphenyl)triazol-1-yl]propanoylamino]ethyl]boronic acid (PubChem CID 71616887) has the molecular formula C22H27BN4O4 and a molecular weight of 422.29 g/mol. Its IUPAC name is [(1R)-2-(3-ethylphenyl)-1-[3-[4-(2-methoxyphenyl)triazol-1-yl]propanoylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(3-ethylphenyl)-1-[3-[4-(2-methoxyphenyl)triazol-1-yl]propanoylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 71616887 |
| Molecular Formula | C22H27BN4O4 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(1R)-2-(3-ethylphenyl)-1-[3-[4-(2-methoxyphenyl)triazol-1-yl]propanoylamino]ethyl]boronic acid |
| SMILES | CCc1cccc(C[C@H](NC(=O)CCn2cc(-c3ccccc3OC)nn2)B(O)O)c1 |
| InChI | InChI=1S/C22H27BN4O4/c1-3-16-7-6-8-17(13-16)14-21(23(29)30)24-22(28)11-12-27-15-19(25-26-27)18-9-4-5-10-20(18)31-2/h4-10,13,15,21,29-30H,3,11-12,14H2,1-2H3,(H,24,28)/t21-/m0/s1 |
| InChIKey | WEXCUYIRSZDPDP-NRFANRHFSA-N |
| XLogP | 1.65 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|