C17H17BBrNO5 — CID 71011546
3-[2-borono-2-[[2-(2-bromophenyl)acetyl]amino]ethyl]benzoic acid (PubChem CID 71011546) has the molecular formula C17H17BBrNO5 and a molecular weight of 406.04 g/mol. Its IUPAC name is 3-[2-borono-2-[[2-(2-bromophenyl)acetyl]amino]ethyl]benzoic acid.
| Compound Name | 3-[2-borono-2-[[2-(2-bromophenyl)acetyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 71011546 |
| Molecular Formula | C17H17BBrNO5 |
| Molecular Weight | 406.04 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 3-[2-borono-2-[[2-(2-bromophenyl)acetyl]amino]ethyl]benzoic acid |
| SMILES | O=C(Cc1ccccc1Br)NC(Cc1cccc(C(=O)O)c1)B(O)O |
| InChI | InChI=1S/C17H17BBrNO5/c19-14-7-2-1-5-12(14)10-16(21)20-15(18(24)25)9-11-4-3-6-13(8-11)17(22)23/h1-8,15,24-25H,9-10H2,(H,20,21)(H,22,23) |
| InChIKey | MERPJRUDSJIHNC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.04 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|