3-(2-bromopropyl)benzoic acid

C10H11BrO2 — CID 174573518

IUPAC3-(2-bromopropyl)benzoic acid
SMILESCC(Br)Cc1cccc(C(=O)O)c1
InChIInChI=1S/C10H11BrO2/c1-7(11)5-8-3-2-4-9(6-8)10(12)13/h2-4,6-7H,5H2,1H3,(H,12,13)
InChIKeyNXIQZAKBNILJTE-UHFFFAOYSA-N
MW243.10 g/mol
LogP2.71
Rot. Bonds3

About 3-(2-bromopropyl)benzoic acid

3-(2-bromopropyl)benzoic acid (PubChem CID 174573518) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 3-(2-bromopropyl)benzoic acid.

Molecular Properties

Compound Name3-(2-bromopropyl)benzoic acid
PubChem CID174573518
Molecular FormulaC10H11BrO2
Molecular Weight243.10 g/mol
Exact Mass241.99
IUPAC Name3-(2-bromopropyl)benzoic acid
SMILESCC(Br)Cc1cccc(C(=O)O)c1
InChIInChI=1S/C10H11BrO2/c1-7(11)5-8-3-2-4-9(6-8)10(12)13/h2-4,6-7H,5H2,1H3,(H,12,13)
InChIKeyNXIQZAKBNILJTE-UHFFFAOYSA-N
XLogP2.71
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.10
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3-(2-bromopropyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-bromopropyl)benzoic acid?
The IUPAC name of 3-(2-bromopropyl)benzoic acid (CID 174573518) is 3-(2-bromopropyl)benzoic acid.
What is the SMILES notation for 3-(2-bromopropyl)benzoic acid?
The canonical SMILES for 3-(2-bromopropyl)benzoic acid is CC(Br)Cc1cccc(C(=O)O)c1.
What is the InChIKey of 3-(2-bromopropyl)benzoic acid?
The InChIKey is NXIQZAKBNILJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-7(11)5-8-3-2-4-9(6-8)10(12)13/h2-4,6-7H,5H2,1H3,(H,12,13).
What are the key properties of 3-(2-bromopropyl)benzoic acid?
3-(2-bromopropyl)benzoic acid has a molecular weight of 243.10 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromopropyl)benzoic acid is sourced from PubChem (CID 174573518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).