About 3-(2-bromopropyl)benzoic acid
3-(2-bromopropyl)benzoic acid (PubChem CID 174573518) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is 3-(2-bromopropyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(2-bromopropyl)benzoic acid |
| PubChem CID | 174573518 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 3-(2-bromopropyl)benzoic acid |
| SMILES | CC(Br)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C10H11BrO2/c1-7(11)5-8-3-2-4-9(6-8)10(12)13/h2-4,6-7H,5H2,1H3,(H,12,13) |
| InChIKey | NXIQZAKBNILJTE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromopropyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromopropyl)benzoic acid?
The IUPAC name of 3-(2-bromopropyl)benzoic acid (CID 174573518) is 3-(2-bromopropyl)benzoic acid.
What is the SMILES notation for 3-(2-bromopropyl)benzoic acid?
The canonical SMILES for 3-(2-bromopropyl)benzoic acid is CC(Br)Cc1cccc(C(=O)O)c1.
What is the InChIKey of 3-(2-bromopropyl)benzoic acid?
The InChIKey is NXIQZAKBNILJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-7(11)5-8-3-2-4-9(6-8)10(12)13/h2-4,6-7H,5H2,1H3,(H,12,13).
What are the key properties of 3-(2-bromopropyl)benzoic acid?
3-(2-bromopropyl)benzoic acid has a molecular weight of 243.10 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromopropyl)benzoic acid is sourced from PubChem (CID 174573518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).