3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid

C17H18O4 — CID 18682979

IUPAC3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid
SMILESO=C(O)c1cccc(CCc2cccc(CC(O)O)c2)c1
InChIInChI=1S/C17H18O4/c18-16(19)11-14-5-1-3-12(9-14)7-8-13-4-2-6-15(10-13)17(20)21/h1-6,9-10,16,18-19H,7-8,11H2,(H,20,21)
InChIKeyVEAYLIIEGQNVFD-UHFFFAOYSA-N
MW286.33 g/mol
LogP2.02
Rot. Bonds6

About 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid

3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid (PubChem CID 18682979) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid.

Molecular Properties

Compound Name3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid
PubChem CID18682979
Molecular FormulaC17H18O4
Molecular Weight286.33 g/mol
Exact Mass286.12
IUPAC Name3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid
SMILESO=C(O)c1cccc(CCc2cccc(CC(O)O)c2)c1
InChIInChI=1S/C17H18O4/c18-16(19)11-14-5-1-3-12(9-14)7-8-13-4-2-6-15(10-13)17(20)21/h1-6,9-10,16,18-19H,7-8,11H2,(H,20,21)
InChIKeyVEAYLIIEGQNVFD-UHFFFAOYSA-N
XLogP2.02
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.33
LogP ≤ 52.02
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid?
The IUPAC name of 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid (CID 18682979) is 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid.
What is the SMILES notation for 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid?
The canonical SMILES for 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid is O=C(O)c1cccc(CCc2cccc(CC(O)O)c2)c1.
What is the InChIKey of 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid?
The InChIKey is VEAYLIIEGQNVFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4/c18-16(19)11-14-5-1-3-12(9-14)7-8-13-4-2-6-15(10-13)17(20)21/h1-6,9-10,16,18-19H,7-8,11H2,(H,20,21).
What are the key properties of 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid?
3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid has a molecular weight of 286.33 g/mol, XLogP of 2.02, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[3-(2,2-dihydroxyethyl)phenyl]ethyl]benzoic acid is sourced from PubChem (CID 18682979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).