About 3-(2-nitroethyl)benzoic acid
3-(2-nitroethyl)benzoic acid (PubChem CID 55250732) has the molecular formula C9H9NO4
and a molecular weight of 195.17 g/mol. Its IUPAC name is 3-(2-nitroethyl)benzoic acid.
Molecular Properties
| Compound Name | 3-(2-nitroethyl)benzoic acid |
| PubChem CID | 55250732 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-(2-nitroethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(CC[N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9NO4/c11-9(12)8-3-1-2-7(6-8)4-5-10(13)14/h1-3,6H,4-5H2,(H,11,12) |
| InChIKey | QSQOWOLWGBJUIY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-nitroethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-nitroethyl)benzoic acid?
The IUPAC name of 3-(2-nitroethyl)benzoic acid (CID 55250732) is 3-(2-nitroethyl)benzoic acid.
What is the SMILES notation for 3-(2-nitroethyl)benzoic acid?
The canonical SMILES for 3-(2-nitroethyl)benzoic acid is O=C(O)c1cccc(CC[N+](=O)[O-])c1.
What is the InChIKey of 3-(2-nitroethyl)benzoic acid?
The InChIKey is QSQOWOLWGBJUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4/c11-9(12)8-3-1-2-7(6-8)4-5-10(13)14/h1-3,6H,4-5H2,(H,11,12).
What are the key properties of 3-(2-nitroethyl)benzoic acid?
3-(2-nitroethyl)benzoic acid has a molecular weight of 195.17 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-nitroethyl)benzoic acid is sourced from PubChem (CID 55250732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).