C16H20BNO6 — CID 71011610
3-[2-borono-2-[(4-cyclopropyl-4-oxobutanoyl)amino]ethyl]benzoic acid (PubChem CID 71011610) has the molecular formula C16H20BNO6 and a molecular weight of 333.15 g/mol. Its IUPAC name is 3-[2-borono-2-[(4-cyclopropyl-4-oxobutanoyl)amino]ethyl]benzoic acid.
| Compound Name | 3-[2-borono-2-[(4-cyclopropyl-4-oxobutanoyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 71011610 |
| Molecular Formula | C16H20BNO6 |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 3-[2-borono-2-[(4-cyclopropyl-4-oxobutanoyl)amino]ethyl]benzoic acid |
| SMILES | O=C(CCC(=O)C1CC1)NC(Cc1cccc(C(=O)O)c1)B(O)O |
| InChI | InChI=1S/C16H20BNO6/c19-13(11-4-5-11)6-7-15(20)18-14(17(23)24)9-10-2-1-3-12(8-10)16(21)22/h1-3,8,11,14,23-24H,4-7,9H2,(H,18,20)(H,21,22) |
| InChIKey | BMYKKCLTANOFRU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|