C26H34BN3O4 — CID 174135602
[(1R)-1-[3-[3-[4-(tert-butylamino)-3-cyano-4-oxobutyl]phenyl]propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 174135602) has the molecular formula C26H34BN3O4 and a molecular weight of 463.39 g/mol. Its IUPAC name is [(1R)-1-[3-[3-[4-(tert-butylamino)-3-cyano-4-oxobutyl]phenyl]propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[3-[3-[4-(tert-butylamino)-3-cyano-4-oxobutyl]phenyl]propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174135602 |
| Molecular Formula | C26H34BN3O4 |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | [(1R)-1-[3-[3-[4-(tert-butylamino)-3-cyano-4-oxobutyl]phenyl]propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)(C)NC(=O)C(C#N)CCc1cccc(CCC(=O)N[C@@H](Cc2ccccc2)B(O)O)c1 |
| InChI | InChI=1S/C26H34BN3O4/c1-26(2,3)30-25(32)22(18-28)14-12-20-10-7-11-21(16-20)13-15-24(31)29-23(27(33)34)17-19-8-5-4-6-9-19/h4-11,16,22-23,33-34H,12-15,17H2,1-3H3,(H,29,31)(H,30,32)/t22?,23-/m0/s1 |
| InChIKey | VCIHTODLRICICY-WCSIJFPASA-N |
| XLogP | 2.35 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|