C26H26BN3O3 — CID 175503907
[(1R)-1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)phenyl]propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid (PubChem CID 175503907) has the molecular formula C26H26BN3O3 and a molecular weight of 439.32 g/mol. Its IUPAC name is [(1R)-1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)phenyl]propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)phenyl]propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 175503907 |
| Molecular Formula | C26H26BN3O3 |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [(1R)-1-[3-[3-(2-cyano-2-pyridin-2-ylethenyl)phenyl]propanoylamino]-2-(4-methylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)CCc2cccc(C=C(C#N)c3ccccn3)c2)B(O)O)cc1 |
| InChI | InChI=1S/C26H26BN3O3/c1-19-8-10-21(11-9-19)17-25(27(32)33)30-26(31)13-12-20-5-4-6-22(15-20)16-23(18-28)24-7-2-3-14-29-24/h2-11,14-16,25,32-33H,12-13,17H2,1H3,(H,30,31)/t25-/m0/s1 |
| InChIKey | CAFXWPBENBQDHW-VWLOTQADSA-N |
| XLogP | 3.13 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|