C26H26BN3O4 — CID 174135820
[(1R)-1-[2-[3-[(Z)-2-cyano-2-pyridin-2-ylethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid (PubChem CID 174135820) has the molecular formula C26H26BN3O4 and a molecular weight of 455.32 g/mol. Its IUPAC name is [(1R)-1-[2-[3-[(Z)-2-cyano-2-pyridin-2-ylethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[2-[3-[(Z)-2-cyano-2-pyridin-2-ylethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 174135820 |
| Molecular Formula | C26H26BN3O4 |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | [(1R)-1-[2-[3-[(Z)-2-cyano-2-pyridin-2-ylethenyl]phenyl]ethoxycarbonylamino]-2-(4-methylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)OCCc2cccc(/C=C(\C#N)c3ccccn3)c2)B(O)O)cc1 |
| InChI | InChI=1S/C26H26BN3O4/c1-19-8-10-21(11-9-19)17-25(27(32)33)30-26(31)34-14-12-20-5-4-6-22(15-20)16-23(18-28)24-7-2-3-13-29-24/h2-11,13,15-16,25,32-33H,12,14,17H2,1H3,(H,30,31)/b23-16+/t25-/m0/s1 |
| InChIKey | YLVUPVUWHZCOTE-ZMIGGIFCSA-N |
| XLogP | 3.35 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|