C27H26BF3N4O3 — CID 150877311
[(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethylcarbamoylamino]-2-(4-methylphenyl)ethyl]boronic acid (PubChem CID 150877311) has the molecular formula C27H26BF3N4O3 and a molecular weight of 522.34 g/mol. Its IUPAC name is [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethylcarbamoylamino]-2-(4-methylphenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethylcarbamoylamino]-2-(4-methylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 150877311 |
| Molecular Formula | C27H26BF3N4O3 |
| Molecular Weight | 522.34 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [(1R)-1-[2-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenyl]ethylcarbamoylamino]-2-(4-methylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)NCCc2cccc(C=C(C#N)c3ccc(C(F)(F)F)cn3)c2)B(O)O)cc1 |
| InChI | InChI=1S/C27H26BF3N4O3/c1-18-5-7-20(8-6-18)15-25(28(37)38)35-26(36)33-12-11-19-3-2-4-21(13-19)14-22(16-32)24-10-9-23(17-34-24)27(29,30)31/h2-10,13-14,17,25,37-38H,11-12,15H2,1H3,(H2,33,35,36)/t25-/m0/s1 |
| InChIKey | KVGRLLAJSVGJEP-VWLOTQADSA-N |
| XLogP | 3.94 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|