C26H23BF3N3O4 — CID 174106214
[1-[3-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 174106214) has the molecular formula C26H23BF3N3O4 and a molecular weight of 509.29 g/mol. Its IUPAC name is [1-[3-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[3-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174106214 |
| Molecular Formula | C26H23BF3N3O4 |
| Molecular Weight | 509.29 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | [1-[3-[3-[2-cyano-2-[5-(trifluoromethyl)-2-pyridinyl]ethenyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | N#CC(=Cc1cccc(OCCC(=O)NC(Cc2ccccc2)B(O)O)c1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C26H23BF3N3O4/c28-26(29,30)21-9-10-23(32-17-21)20(16-31)13-19-7-4-8-22(14-19)37-12-11-25(34)33-24(27(35)36)15-18-5-2-1-3-6-18/h1-10,13-14,17,24,35-36H,11-12,15H2,(H,33,34) |
| InChIKey | WFALJDOVRLLALU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|