C28H33BN4O6 — CID 174106148
[1-[3-[3-[2-cyano-3-[4-(oxetan-3-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 174106148) has the molecular formula C28H33BN4O6 and a molecular weight of 532.41 g/mol. Its IUPAC name is [1-[3-[3-[2-cyano-3-[4-(oxetan-3-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[3-[3-[2-cyano-3-[4-(oxetan-3-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174106148 |
| Molecular Formula | C28H33BN4O6 |
| Molecular Weight | 532.41 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | [1-[3-[3-[2-cyano-3-[4-(oxetan-3-yl)piperazin-1-yl]-3-oxoprop-1-enyl]phenoxy]propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | N#CC(=Cc1cccc(OCCC(=O)NC(Cc2ccccc2)B(O)O)c1)C(=O)N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C28H33BN4O6/c30-18-23(28(35)33-12-10-32(11-13-33)24-19-38-20-24)15-22-7-4-8-25(16-22)39-14-9-27(34)31-26(29(36)37)17-21-5-2-1-3-6-21/h1-8,15-16,24,26,36-37H,9-14,17,19-20H2,(H,31,34) |
| InChIKey | UWXBWOGIMFVMFN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|