C29H32BN3O7 — CID 164850560
[(1R)-2-(1-benzofuran-3-yl)-1-[2-[3-[2-cyano-3-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid (PubChem CID 164850560) has the molecular formula C29H32BN3O7 and a molecular weight of 545.40 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[2-[3-[2-cyano-3-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[2-[3-[2-cyano-3-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 164850560 |
| Molecular Formula | C29H32BN3O7 |
| Molecular Weight | 545.40 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[2-[3-[2-cyano-3-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]phenyl]ethoxycarbonylamino]ethyl]boronic acid |
| SMILES | C[C@@H]1COC[C@@H](C)N1C(=O)C(C#N)=Cc1cccc(CCOC(=O)N[C@@H](Cc2coc3ccccc23)B(O)O)c1 |
| InChI | InChI=1S/C29H32BN3O7/c1-19-16-38-17-20(2)33(19)28(34)23(15-31)13-22-7-5-6-21(12-22)10-11-39-29(35)32-27(30(36)37)14-24-18-40-26-9-4-3-8-25(24)26/h3-9,12-13,18-20,27,36-37H,10-11,14,16-17H2,1-2H3,(H,32,35)/t19-,20-,27+/m1/s1 |
| InChIKey | WGBHUNZYOJRVMC-DVHCVUMVSA-N |
| XLogP | 2.87 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|