C27H32BF3N4O6 — CID 153277863
[(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-4-fluoropyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid (PubChem CID 153277863) has the molecular formula C27H32BF3N4O6 and a molecular weight of 576.38 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-4-fluoropyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-4-fluoropyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 153277863 |
| Molecular Formula | C27H32BF3N4O6 |
| Molecular Weight | 576.38 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-4-fluoropyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1C[C@@H](F)C[C@@H]1COC(=O)N[C@@H](Cc1coc2ccccc12)B(O)O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C27H32BF3N4O6/c1-26(2,34-8-7-27(30,31)16-34)11-18(12-32)24(36)35-13-19(29)10-20(35)15-41-25(37)33-23(28(38)39)9-17-14-40-22-6-4-3-5-21(17)22/h3-6,11,14,19-20,23,38-39H,7-10,13,15-16H2,1-2H3,(H,33,37)/t19-,20+,23-/m0/s1 |
| InChIKey | XWULAOAXHUXKKJ-MZKRTTBSSA-N |
| XLogP | 2.59 |
| TPSA | 139.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|