C19H22BFN2O6 — CID 153277798
[(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid (PubChem CID 153277798) has the molecular formula C19H22BFN2O6 and a molecular weight of 404.20 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 153277798 |
| Molecular Formula | C19H22BFN2O6 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-2-yl]methoxycarbonylamino]ethyl]boronic acid |
| SMILES | C=CC(=O)N1C[C@@H](F)C[C@@H]1COC(=O)N[C@@H](Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C19H22BFN2O6/c1-2-18(24)23-9-13(21)8-14(23)11-29-19(25)22-17(20(26)27)7-12-10-28-16-6-4-3-5-15(12)16/h2-6,10,13-14,17,26-27H,1,7-9,11H2,(H,22,25)/t13-,14+,17-/m0/s1 |
| InChIKey | QSSRGWYKBYNFCW-VBQJREDUSA-N |
| XLogP | 1.21 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|