C21H22BNO6 — CID 175305623
[(1R)-2-(1-benzofuran-3-yl)-1-(3,4-dihydro-2H-chromen-7-ylmethoxycarbonylamino)ethyl]boronic acid (PubChem CID 175305623) has the molecular formula C21H22BNO6 and a molecular weight of 395.22 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-(3,4-dihydro-2H-chromen-7-ylmethoxycarbonylamino)ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-(3,4-dihydro-2H-chromen-7-ylmethoxycarbonylamino)ethyl]boronic acid |
|---|---|
| PubChem CID | 175305623 |
| Molecular Formula | C21H22BNO6 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-(3,4-dihydro-2H-chromen-7-ylmethoxycarbonylamino)ethyl]boronic acid |
| SMILES | O=C(N[C@@H](Cc1coc2ccccc12)B(O)O)OCc1ccc2c(c1)OCCC2 |
| InChI | InChI=1S/C21H22BNO6/c24-21(29-12-14-7-8-15-4-3-9-27-19(15)10-14)23-20(22(25)26)11-16-13-28-18-6-2-1-5-17(16)18/h1-2,5-8,10,13,20,25-26H,3-4,9,11-12H2,(H,23,24)/t20-/m0/s1 |
| InChIKey | HCXGDKCKWVCIGI-FQEVSTJZSA-N |
| XLogP | 2.61 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|