C24H26BNO5 — CID 175360912
[2-(1-benzofuran-3-yl)-1-[(2-spiro[2,4-dihydrochromene-3,1'-cyclobutane]-6-ylacetyl)amino]ethyl]boronic acid (PubChem CID 175360912) has the molecular formula C24H26BNO5 and a molecular weight of 419.29 g/mol. Its IUPAC name is [2-(1-benzofuran-3-yl)-1-[(2-spiro[2,4-dihydrochromene-3,1'-cyclobutane]-6-ylacetyl)amino]ethyl]boronic acid.
| Compound Name | [2-(1-benzofuran-3-yl)-1-[(2-spiro[2,4-dihydrochromene-3,1'-cyclobutane]-6-ylacetyl)amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 175360912 |
| Molecular Formula | C24H26BNO5 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [2-(1-benzofuran-3-yl)-1-[(2-spiro[2,4-dihydrochromene-3,1'-cyclobutane]-6-ylacetyl)amino]ethyl]boronic acid |
| SMILES | O=C(Cc1ccc2c(c1)CC1(CCC1)CO2)NC(Cc1coc2ccccc12)B(O)O |
| InChI | InChI=1S/C24H26BNO5/c27-23(11-16-6-7-20-17(10-16)13-24(15-31-20)8-3-9-24)26-22(25(28)29)12-18-14-30-21-5-2-1-4-19(18)21/h1-2,4-7,10,14,22,28-29H,3,8-9,11-13,15H2,(H,26,27) |
| InChIKey | UJABKSRWVAPUTH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|