C31H42BN5O7 — CID 153277670
[(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]ethyl]boronic acid (PubChem CID 153277670) has the molecular formula C31H42BN5O7 and a molecular weight of 607.52 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]ethyl]boronic acid |
|---|---|
| PubChem CID | 153277670 |
| Molecular Formula | C31H42BN5O7 |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]ethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCCC[C@@H]1COC(=O)N[C@@H](Cc1coc2ccccc12)B(O)O)N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C31H42BN5O7/c1-31(2,36-13-11-35(12-14-36)25-19-42-20-25)16-23(17-33)29(38)37-10-6-5-7-24(37)21-44-30(39)34-28(32(40)41)15-22-18-43-27-9-4-3-8-26(22)27/h3-4,8-9,16,18,24-25,28,40-41H,5-7,10-15,19-21H2,1-2H3,(H,34,39)/t24-,28+/m1/s1 |
| InChIKey | ZJZPZQIBXOPHPY-YWEHKCAJSA-N |
| XLogP | 1.71 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|