C29H41BFN5O6 — CID 147332243
[(1R)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-(4-fluorophenyl)ethyl]boronic acid (PubChem CID 147332243) has the molecular formula C29H41BFN5O6 and a molecular weight of 585.49 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-(4-fluorophenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-(4-fluorophenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 147332243 |
| Molecular Formula | C29H41BFN5O6 |
| Molecular Weight | 585.49 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | [(1R)-1-[[(2R)-1-[2-cyano-4-methyl-4-[4-(oxetan-3-yl)piperazin-1-yl]pent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-(4-fluorophenyl)ethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCCC[C@@H]1COC(=O)N[C@@H](Cc1ccc(F)cc1)B(O)O)N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C29H41BFN5O6/c1-29(2,35-13-11-34(12-14-35)25-18-41-19-25)16-22(17-32)27(37)36-10-4-3-5-24(36)20-42-28(38)33-26(30(39)40)15-21-6-8-23(31)9-7-21/h6-9,16,24-26,39-40H,3-5,10-15,18-20H2,1-2H3,(H,33,38)/t24-,26+/m1/s1 |
| InChIKey | DBWLZSYECSJPPU-RSXGOPAZSA-N |
| XLogP | 1.10 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|