C29H41BN4O6 — CID 154639157
[(1R)-1-[[7-[2-cyano-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 154639157) has the molecular formula C29H41BN4O6 and a molecular weight of 552.48 g/mol. Its IUPAC name is [(1R)-1-[[7-[2-cyano-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[7-[2-cyano-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 154639157 |
| Molecular Formula | C29H41BN4O6 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | [(1R)-1-[[7-[2-cyano-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | C[C@H]1CN(C(C)(C)C=C(C#N)C(=O)N2C3CCC2(COC(=O)N[C@@H](Cc2ccccc2)B(O)O)CC3)C[C@H](C)O1 |
| InChI | InChI=1S/C29H41BN4O6/c1-20-17-33(18-21(2)40-20)28(3,4)15-23(16-31)26(35)34-24-10-12-29(34,13-11-24)19-39-27(36)32-25(30(37)38)14-22-8-6-5-7-9-22/h5-9,15,20-21,24-25,37-38H,10-14,17-19H2,1-4H3,(H,32,36)/t20-,21-,24?,25-,29?/m0/s1 |
| InChIKey | NHTYCEJOKVJPLX-BBXZKNIQSA-N |
| XLogP | 2.20 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|