C27H34BF5N4O5 — CID 153277788
[(1R)-1-[[(2R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-[4-(trifluoromethyl)phenyl]ethyl]boronic acid (PubChem CID 153277788) has the molecular formula C27H34BF5N4O5 and a molecular weight of 600.39 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-[4-(trifluoromethyl)phenyl]ethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-[4-(trifluoromethyl)phenyl]ethyl]boronic acid |
|---|---|
| PubChem CID | 153277788 |
| Molecular Formula | C27H34BF5N4O5 |
| Molecular Weight | 600.39 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | [(1R)-1-[[(2R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-[4-(trifluoromethyl)phenyl]ethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCCC[C@@H]1COC(=O)N[C@@H](Cc1ccc(C(F)(F)F)cc1)B(O)O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C27H34BF5N4O5/c1-25(2,36-12-10-26(29,30)17-36)14-19(15-34)23(38)37-11-4-3-5-21(37)16-42-24(39)35-22(28(40)41)13-18-6-8-20(9-7-18)27(31,32)33/h6-9,14,21-22,40-41H,3-5,10-13,16-17H2,1-2H3,(H,35,39)/t21-,22+/m1/s1 |
| InChIKey | ZJOOZQMNRAMESJ-YADHBBJMSA-N |
| XLogP | 3.31 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|