C25H34BF2N5O4 — CID 154639135
[(1R)-1-[[(3R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid (PubChem CID 154639135) has the molecular formula C25H34BF2N5O4 and a molecular weight of 517.39 g/mol. Its IUPAC name is [(1R)-1-[[(3R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(3R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 154639135 |
| Molecular Formula | C25H34BF2N5O4 |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [(1R)-1-[[(3R)-1-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]piperidin-3-yl]carbamoylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CCC[C@@H](NC(=O)N[C@@H](Cc2ccccc2)B(O)O)C1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C25H34BF2N5O4/c1-24(2,33-12-10-25(27,28)17-33)14-19(15-29)22(34)32-11-6-9-20(16-32)30-23(35)31-21(26(36)37)13-18-7-4-3-5-8-18/h3-5,7-8,14,20-21,36-37H,6,9-13,16-17H2,1-2H3,(H2,30,31,35)/t20-,21+/m1/s1 |
| InChIKey | GPCDKFXIVLJFHT-RTWAWAEBSA-N |
| XLogP | 1.47 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|