C15H21F2N3O2 — CID 150373605
4-(3,3-difluoropyrrolidin-1-yl)-2-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile (PubChem CID 150373605) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-2-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile.
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-2-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 150373605 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-2-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile |
| SMILES | CC(C)(C=C(C#N)C(=O)N1CC[C@H](O)C1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C15H21F2N3O2/c1-14(2,20-6-4-15(16,17)10-20)7-11(8-18)13(22)19-5-3-12(21)9-19/h7,12,21H,3-6,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | GYFQVXOMTPNQIU-LBPRGKRZSA-N |
| XLogP | 1.15 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|