C15H22F2N4O — CID 155074042
(Z)-2-[(3S)-3-aminopyrrolidine-1-carbonyl]-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enenitrile (PubChem CID 155074042) has the molecular formula C15H22F2N4O and a molecular weight of 312.36 g/mol. Its IUPAC name is (Z)-2-[(3S)-3-aminopyrrolidine-1-carbonyl]-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enenitrile.
| Compound Name | (Z)-2-[(3S)-3-aminopyrrolidine-1-carbonyl]-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 155074042 |
| Molecular Formula | C15H22F2N4O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (Z)-2-[(3S)-3-aminopyrrolidine-1-carbonyl]-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enenitrile |
| SMILES | CC(C)(/C=C(/C#N)C(=O)N1CC[C@H](N)C1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C15H22F2N4O/c1-14(2,21-6-4-15(16,17)10-21)7-11(8-18)13(22)20-5-3-12(19)9-20/h7,12H,3-6,9-10,19H2,1-2H3/b11-7-/t12-/m0/s1 |
| InChIKey | NZVZKEVAVKRFPL-RDQDRAATSA-N |
| XLogP | 1.12 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|