C15H22N2O2 — CID 170620456
(E)-2-(3-acetylpiperidine-1-carbonyl)-4,4-dimethylpent-2-enenitrile (PubChem CID 170620456) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (E)-2-(3-acetylpiperidine-1-carbonyl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-(3-acetylpiperidine-1-carbonyl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 170620456 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (E)-2-(3-acetylpiperidine-1-carbonyl)-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(=O)C1CCCN(C(=O)/C(C#N)=C/C(C)(C)C)C1 |
| InChI | InChI=1S/C15H22N2O2/c1-11(18)12-6-5-7-17(10-12)14(19)13(9-16)8-15(2,3)4/h8,12H,5-7,10H2,1-4H3/b13-8+ |
| InChIKey | KYSFAAZGMKQVNL-MDWZMJQESA-N |
| XLogP | 2.31 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|