C27H35BF2N4O5 — CID 151555117
[(1R)-1-[[7-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 151555117) has the molecular formula C27H35BF2N4O5 and a molecular weight of 544.41 g/mol. Its IUPAC name is [(1R)-1-[[7-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[7-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 151555117 |
| Molecular Formula | C27H35BF2N4O5 |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | [(1R)-1-[[7-[2-cyano-4-(3,3-difluoropyrrolidin-1-yl)-4-methylpent-2-enoyl]-7-azabicyclo[2.2.1]heptan-1-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)N1C2CCC1(COC(=O)N[C@@H](Cc1ccccc1)B(O)O)CC2)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C27H35BF2N4O5/c1-25(2,33-13-12-27(29,30)17-33)15-20(16-31)23(35)34-21-8-10-26(34,11-9-21)18-39-24(36)32-22(28(37)38)14-19-6-4-3-5-7-19/h3-7,15,21-22,37-38H,8-14,17-18H2,1-2H3,(H,32,36)/t21?,22-,26?/m0/s1 |
| InChIKey | QBHRNNANKAGHNR-HCYSDIRSSA-N |
| XLogP | 2.43 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|