C28H40BN5O7 — CID 153277881
[(1R)-1-[[(2R)-1-[2-cyano-4-(4-methoxycarbonylpiperazin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid (PubChem CID 153277881) has the molecular formula C28H40BN5O7 and a molecular weight of 569.47 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-1-[2-cyano-4-(4-methoxycarbonylpiperazin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-1-[2-cyano-4-(4-methoxycarbonylpiperazin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 153277881 |
| Molecular Formula | C28H40BN5O7 |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | [(1R)-1-[[(2R)-1-[2-cyano-4-(4-methoxycarbonylpiperazin-1-yl)-4-methylpent-2-enoyl]piperidin-2-yl]methoxycarbonylamino]-2-phenylethyl]boronic acid |
| SMILES | COC(=O)N1CCN(C(C)(C)C=C(C#N)C(=O)N2CCCC[C@@H]2COC(=O)N[C@@H](Cc2ccccc2)B(O)O)CC1 |
| InChI | InChI=1S/C28H40BN5O7/c1-28(2,33-15-13-32(14-16-33)27(37)40-3)18-22(19-30)25(35)34-12-8-7-11-23(34)20-41-26(36)31-24(29(38)39)17-21-9-5-4-6-10-21/h4-6,9-10,18,23-24,38-39H,7-8,11-17,20H2,1-3H3,(H,31,36)/t23-,24+/m1/s1 |
| InChIKey | PPYLUGUXUZGWDC-RPWUZVMVSA-N |
| XLogP | 1.33 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|