C26H36BF3N4O5 — CID 154639177
[(1R)-1-[[(2S)-3-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methoxy]-2-(2,2,2-trifluoroethylamino)propanoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 154639177) has the molecular formula C26H36BF3N4O5 and a molecular weight of 552.40 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-3-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methoxy]-2-(2,2,2-trifluoroethylamino)propanoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-3-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methoxy]-2-(2,2,2-trifluoroethylamino)propanoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 154639177 |
| Molecular Formula | C26H36BF3N4O5 |
| Molecular Weight | 552.40 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | [(1R)-1-[[(2S)-3-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)piperidin-2-yl]methoxy]-2-(2,2,2-trifluoroethylamino)propanoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)C=C(C#N)C(=O)N1CCCC[C@@H]1COC[C@H](NCC(F)(F)F)C(=O)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C26H36BF3N4O5/c1-18(2)12-20(14-31)25(36)34-11-7-6-10-21(34)15-39-16-22(32-17-26(28,29)30)24(35)33-23(27(37)38)13-19-8-4-3-5-9-19/h3-5,8-9,12,18,21-23,32,37-38H,6-7,10-11,13,15-17H2,1-2H3,(H,33,35)/t21-,22+,23+/m1/s1 |
| InChIKey | PQRSXLZQIJSGCR-VJBWXMMDSA-N |
| XLogP | 1.75 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|