C23H33BN4O5 — CID 142596160
[(1R)-1-[[(2S)-2-acetamido-6-[[(E)-2-cyano-4-methylpent-2-enoyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 142596160) has the molecular formula C23H33BN4O5 and a molecular weight of 456.35 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-acetamido-6-[[(E)-2-cyano-4-methylpent-2-enoyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-acetamido-6-[[(E)-2-cyano-4-methylpent-2-enoyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 142596160 |
| Molecular Formula | C23H33BN4O5 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(1R)-1-[[(2S)-2-acetamido-6-[[(E)-2-cyano-4-methylpent-2-enoyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)/C(C#N)=C/C(C)C)C(=O)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C23H33BN4O5/c1-16(2)13-19(15-25)22(30)26-12-8-7-11-20(27-17(3)29)23(31)28-21(24(32)33)14-18-9-5-4-6-10-18/h4-6,9-10,13,16,20-21,32-33H,7-8,11-12,14H2,1-3H3,(H,26,30)(H,27,29)(H,28,31)/b19-13+/t20-,21-/m0/s1 |
| InChIKey | NEWHOOMLTCXQBI-YBUCYZLGSA-N |
| XLogP | 0.62 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|